C15H20N2O4 — CID 9018198
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-methylbenzoate (PubChem CID 9018198) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-methylbenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 9018198 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 4-methylbenzoate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-3-8-16-13(18)9-17-14(19)10-21-15(20)12-6-4-11(2)5-7-12/h4-7H,3,8-10H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | PYPXMBGHWIORFA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |