C19H21NO4 — CID 2645186
[2-(butylamino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 2645186) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 2645186 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | CCCCNC(=O)COC(=O)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-2-3-12-20-18(22)13-24-19(23)16-6-4-14(5-7-16)15-8-10-17(21)11-9-15/h4-11,21H,2-3,12-13H2,1H3,(H,20,22) |
| InChIKey | HBFDXJCIHHXHGQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|