C16H22N2O5S — CID 30810938
[2-(butylamino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate (PubChem CID 30810938) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30810938 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate |
| SMILES | CCCCNC(=O)COC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-2-3-10-17-15(19)11-23-16(20)12-4-8-14(9-5-12)24(21,22)18-13-6-7-13/h4-5,8-9,13,18H,2-3,6-7,10-11H2,1H3,(H,17,19) |
| InChIKey | JJLJYOMFKALZNL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|