C19H19NO5S — CID 55380270
[2-(4-methylphenyl)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate (PubChem CID 55380270) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55380270 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-13-2-4-14(5-3-13)18(21)12-25-19(22)15-6-10-17(11-7-15)26(23,24)20-16-8-9-16/h2-7,10-11,16,20H,8-9,12H2,1H3 |
| InChIKey | NVWHNAVIGWXBOI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |