C19H19ClN2O5S — CID 46818612
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate (PubChem CID 46818612) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46818612 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 4-(cyclopropylsulfamoyl)benzoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C19H19ClN2O5S/c1-12-16(20)3-2-4-17(12)21-18(23)11-27-19(24)13-5-9-15(10-6-13)28(25,26)22-14-7-8-14/h2-6,9-10,14,22H,7-8,11H2,1H3,(H,21,23) |
| InChIKey | YVNOQDROWRFSQZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |