C23H21ClN2O5S — CID 29141441
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 29141441) has the molecular formula C23H21ClN2O5S and a molecular weight of 472.95 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 29141441 |
| Molecular Formula | C23H21ClN2O5S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H21ClN2O5S/c1-16-20(24)11-6-12-21(16)26-22(27)15-31-23(28)18-9-5-10-19(13-18)32(29,30)25-14-17-7-3-2-4-8-17/h2-13,25H,14-15H2,1H3,(H,26,27) |
| InChIKey | BJFIOLGWEIOIAV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |