C23H21NO5S — CID 25047077
[2-(4-methylphenyl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 25047077) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 25047077 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cccc(S(=O)(=O)NCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H21NO5S/c1-17-10-12-19(13-11-17)22(25)16-29-23(26)20-8-5-9-21(14-20)30(27,28)24-15-18-6-3-2-4-7-18/h2-14,24H,15-16H2,1H3 |
| InChIKey | VJMJNKGGOOTISL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |