C25H28N2O5S — CID 4554079
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 4554079) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4554079 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | CCCn1c(C)cc(C(=O)COC(=O)c2cccc(S(=O)(=O)NCc3ccccc3)c2)c1C |
| InChI | InChI=1S/C25H28N2O5S/c1-4-13-27-18(2)14-23(19(27)3)24(28)17-32-25(29)21-11-8-12-22(15-21)33(30,31)26-16-20-9-6-5-7-10-20/h5-12,14-15,26H,4,13,16-17H2,1-3H3 |
| InChIKey | IKOWQBSUKHZZRM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |