C18H17F3N2O5S — CID 2096209
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 2096209) has the molecular formula C18H17F3N2O5S and a molecular weight of 430.40 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2096209 |
| Molecular Formula | C18H17F3N2O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1)NCC(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O5S/c19-18(20,21)12-22-16(24)11-28-17(25)14-7-4-8-15(9-14)29(26,27)23-10-13-5-2-1-3-6-13/h1-9,23H,10-12H2,(H,22,24) |
| InChIKey | LYMVOKKMBOPDBQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |