C22H17Cl3N2O5S — CID 2382502
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 2382502) has the molecular formula C22H17Cl3N2O5S and a molecular weight of 527.81 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2382502 |
| Molecular Formula | C22H17Cl3N2O5S |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O5S/c23-16-10-18(24)21(19(25)11-16)27-20(28)13-32-22(29)15-7-4-8-17(9-15)33(30,31)26-12-14-5-2-1-3-6-14/h1-11,26H,12-13H2,(H,27,28) |
| InChIKey | WDYGLEUJKVKYOM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |