C11H9F4NO3 — CID 2455236
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-fluorobenzoate (PubChem CID 2455236) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-fluorobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 2455236 |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(F)c1)NCC(F)(F)F |
| InChI | InChI=1S/C11H9F4NO3/c12-8-3-1-2-7(4-8)10(18)19-5-9(17)16-6-11(13,14)15/h1-4H,5-6H2,(H,16,17) |
| InChIKey | AODJUMWAGREPNK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |