C16H20FNO3 — CID 8612564
[2-(cyclohexylmethylamino)-2-oxoethyl] 3-fluorobenzoate (PubChem CID 8612564) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 8612564 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 3-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(F)c1)NCC1CCCCC1 |
| InChI | InChI=1S/C16H20FNO3/c17-14-8-4-7-13(9-14)16(20)21-11-15(19)18-10-12-5-2-1-3-6-12/h4,7-9,12H,1-3,5-6,10-11H2,(H,18,19) |
| InChIKey | JNRUMKLYRWEKFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |