C16H20N2O5 — CID 2623721
[2-(cyclohexylmethylamino)-2-oxoethyl] 3-nitrobenzoate (PubChem CID 2623721) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2623721 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cccc([N+](=O)[O-])c1)NCC1CCCCC1 |
| InChI | InChI=1S/C16H20N2O5/c19-15(17-10-12-5-2-1-3-6-12)11-23-16(20)13-7-4-8-14(9-13)18(21)22/h4,7-9,12H,1-3,5-6,10-11H2,(H,17,19) |
| InChIKey | PQYSFOYQAHKPHG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|