About (cyclohexylamino) 3-nitrobenzoate
(cyclohexylamino) 3-nitrobenzoate (PubChem CID 87667108) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is (cyclohexylamino) 3-nitrobenzoate.
Molecular Properties
| Compound Name | (cyclohexylamino) 3-nitrobenzoate |
| PubChem CID | 87667108 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (cyclohexylamino) 3-nitrobenzoate |
| SMILES | O=C(ONC1CCCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O4/c16-13(19-14-11-6-2-1-3-7-11)10-5-4-8-12(9-10)15(17)18/h4-5,8-9,11,14H,1-3,6-7H2 |
| InChIKey | WPKRPPRYPMONNY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyclohexylamino) 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclohexylamino) 3-nitrobenzoate?
The IUPAC name of (cyclohexylamino) 3-nitrobenzoate (CID 87667108) is (cyclohexylamino) 3-nitrobenzoate.
What is the SMILES notation for (cyclohexylamino) 3-nitrobenzoate?
The canonical SMILES for (cyclohexylamino) 3-nitrobenzoate is O=C(ONC1CCCCC1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of (cyclohexylamino) 3-nitrobenzoate?
The InChIKey is WPKRPPRYPMONNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c16-13(19-14-11-6-2-1-3-7-11)10-5-4-8-12(9-10)15(17)18/h4-5,8-9,11,14H,1-3,6-7H2.
What are the key properties of (cyclohexylamino) 3-nitrobenzoate?
(cyclohexylamino) 3-nitrobenzoate has a molecular weight of 264.28 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclohexylamino) 3-nitrobenzoate is sourced from PubChem (CID 87667108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).