About cycloheptane;1-(3-nitrophenyl)ethanone
cycloheptane;1-(3-nitrophenyl)ethanone (PubChem CID 142103484) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is cycloheptane;1-(3-nitrophenyl)ethanone.
Molecular Properties
| Compound Name | cycloheptane;1-(3-nitrophenyl)ethanone |
| PubChem CID | 142103484 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | cycloheptane;1-(3-nitrophenyl)ethanone |
| SMILES | C1CCCCCC1.CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7NO3.C7H14/c1-6(10)7-3-2-4-8(5-7)9(11)12;1-2-4-6-7-5-3-1/h2-5H,1H3;1-7H2 |
| InChIKey | XZAIAIRDVDRGBZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cycloheptane;1-(3-nitrophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptane;1-(3-nitrophenyl)ethanone?
The IUPAC name of cycloheptane;1-(3-nitrophenyl)ethanone (CID 142103484) is cycloheptane;1-(3-nitrophenyl)ethanone.
What is the SMILES notation for cycloheptane;1-(3-nitrophenyl)ethanone?
The canonical SMILES for cycloheptane;1-(3-nitrophenyl)ethanone is C1CCCCCC1.CC(=O)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of cycloheptane;1-(3-nitrophenyl)ethanone?
The InChIKey is XZAIAIRDVDRGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C7H14/c1-6(10)7-3-2-4-8(5-7)9(11)12;1-2-4-6-7-5-3-1/h2-5H,1H3;1-7H2.
What are the key properties of cycloheptane;1-(3-nitrophenyl)ethanone?
cycloheptane;1-(3-nitrophenyl)ethanone has a molecular weight of 263.34 g/mol, XLogP of 4.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptane;1-(3-nitrophenyl)ethanone is sourced from PubChem (CID 142103484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).