About N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide
N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide (PubChem CID 108513258) has the molecular formula C16H13N3O5
and a molecular weight of 327.30 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide.
Molecular Properties
| Compound Name | N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide |
| PubChem CID | 108513258 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H13N3O5/c1-10(20)11-5-7-12(8-6-11)17-15(21)16(22)18-13-3-2-4-14(9-13)19(23)24/h2-9H,1H3,(H,17,21)(H,18,22) |
| InChIKey | OJHQVYUSFYMFMH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide?
The IUPAC name of N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide (CID 108513258) is N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide.
What is the SMILES notation for N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide?
The canonical SMILES for N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide is CC(=O)c1ccc(NC(=O)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1.
What is the InChIKey of N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide?
The InChIKey is OJHQVYUSFYMFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O5/c1-10(20)11-5-7-12(8-6-11)17-15(21)16(22)18-13-3-2-4-14(9-13)19(23)24/h2-9H,1H3,(H,17,21)(H,18,22).
What are the key properties of N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide?
N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide has a molecular weight of 327.30 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetylphenyl)-N'-(3-nitrophenyl)oxamide is sourced from PubChem (CID 108513258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).