C17H15N3O6 — CID 108515064
N-(3-acetylphenyl)-N'-(2-methoxy-5-nitrophenyl)oxamide (PubChem CID 108515064) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-(2-methoxy-5-nitrophenyl)oxamide.
| Compound Name | N-(3-acetylphenyl)-N'-(2-methoxy-5-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 108515064 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(3-acetylphenyl)-N'-(2-methoxy-5-nitrophenyl)oxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C17H15N3O6/c1-10(21)11-4-3-5-12(8-11)18-16(22)17(23)19-14-9-13(20(24)25)6-7-15(14)26-2/h3-9H,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | MMIUPTPSIGNYCX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|