About 3-nitrobenzoyl iodide
3-nitrobenzoyl iodide (PubChem CID 87511250) has the molecular formula C7H4INO3
and a molecular weight of 277.02 g/mol. Its IUPAC name is 3-nitrobenzoyl iodide.
Molecular Properties
| Compound Name | 3-nitrobenzoyl iodide |
| PubChem CID | 87511250 |
| Molecular Formula | C7H4INO3 |
| Molecular Weight | 277.02 g/mol |
| Exact Mass | 276.92 |
| IUPAC Name | 3-nitrobenzoyl iodide |
| SMILES | O=C(I)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4INO3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H |
| InChIKey | SMWFRALHHOYWRY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.02 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzoyl iodide?
The IUPAC name of 3-nitrobenzoyl iodide (CID 87511250) is 3-nitrobenzoyl iodide.
What is the SMILES notation for 3-nitrobenzoyl iodide?
The canonical SMILES for 3-nitrobenzoyl iodide is O=C(I)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitrobenzoyl iodide?
The InChIKey is SMWFRALHHOYWRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4INO3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H.
What are the key properties of 3-nitrobenzoyl iodide?
3-nitrobenzoyl iodide has a molecular weight of 277.02 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzoyl iodide is sourced from PubChem (CID 87511250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).