About benzoyl bromide;1,3-dinitrobenzene
benzoyl bromide;1,3-dinitrobenzene (PubChem CID 174634067) has the molecular formula C13H9BrN2O5
and a molecular weight of 353.13 g/mol. Its IUPAC name is benzoyl bromide;1,3-dinitrobenzene.
Molecular Properties
| Compound Name | benzoyl bromide;1,3-dinitrobenzene |
| PubChem CID | 174634067 |
| Molecular Formula | C13H9BrN2O5 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | benzoyl bromide;1,3-dinitrobenzene |
| SMILES | O=C(Br)c1ccccc1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5BrO.C6H4N2O4/c8-7(9)6-4-2-1-3-5-6;9-7(10)5-2-1-3-6(4-5)8(11)12/h1-5H;1-4H |
| InChIKey | FQGACSJTGAGUAQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzoyl bromide;1,3-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl bromide;1,3-dinitrobenzene?
The IUPAC name of benzoyl bromide;1,3-dinitrobenzene (CID 174634067) is benzoyl bromide;1,3-dinitrobenzene.
What is the SMILES notation for benzoyl bromide;1,3-dinitrobenzene?
The canonical SMILES for benzoyl bromide;1,3-dinitrobenzene is O=C(Br)c1ccccc1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of benzoyl bromide;1,3-dinitrobenzene?
The InChIKey is FQGACSJTGAGUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.C6H4N2O4/c8-7(9)6-4-2-1-3-5-6;9-7(10)5-2-1-3-6(4-5)8(11)12/h1-5H;1-4H.
What are the key properties of benzoyl bromide;1,3-dinitrobenzene?
benzoyl bromide;1,3-dinitrobenzene has a molecular weight of 353.13 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl bromide;1,3-dinitrobenzene is sourced from PubChem (CID 174634067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).