About (3-nitrophenyl)-phenylmethanone;thiourea
(3-nitrophenyl)-phenylmethanone;thiourea (PubChem CID 174541528) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is (3-nitrophenyl)-phenylmethanone;thiourea.
Molecular Properties
| Compound Name | (3-nitrophenyl)-phenylmethanone;thiourea |
| PubChem CID | 174541528 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (3-nitrophenyl)-phenylmethanone;thiourea |
| SMILES | NC(N)=S.O=C(c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9NO3.CH4N2S/c15-13(10-5-2-1-3-6-10)11-7-4-8-12(9-11)14(16)17;2-1(3)4/h1-9H;(H4,2,3,4) |
| InChIKey | QNSFECJNYKEFDO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl)-phenylmethanone;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl)-phenylmethanone;thiourea?
The IUPAC name of (3-nitrophenyl)-phenylmethanone;thiourea (CID 174541528) is (3-nitrophenyl)-phenylmethanone;thiourea.
What is the SMILES notation for (3-nitrophenyl)-phenylmethanone;thiourea?
The canonical SMILES for (3-nitrophenyl)-phenylmethanone;thiourea is NC(N)=S.O=C(c1ccccc1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of (3-nitrophenyl)-phenylmethanone;thiourea?
The InChIKey is QNSFECJNYKEFDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.CH4N2S/c15-13(10-5-2-1-3-6-10)11-7-4-8-12(9-11)14(16)17;2-1(3)4/h1-9H;(H4,2,3,4).
What are the key properties of (3-nitrophenyl)-phenylmethanone;thiourea?
(3-nitrophenyl)-phenylmethanone;thiourea has a molecular weight of 303.34 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl)-phenylmethanone;thiourea is sourced from PubChem (CID 174541528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).