About hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride
hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride (PubChem CID 172745216) has the molecular formula C13H14ClN3O3
and a molecular weight of 295.73 g/mol. Its IUPAC name is hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride.
Molecular Properties
| Compound Name | hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride |
| PubChem CID | 172745216 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride |
| SMILES | Cl.NN.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.ClH.H4N2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;;1-2/h1-9H;1H;1-2H2 |
| InChIKey | JPZKKGMWQJUPNF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride?
The IUPAC name of hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride (CID 172745216) is hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride.
What is the SMILES notation for hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride?
The canonical SMILES for hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride is Cl.NN.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride?
The InChIKey is JPZKKGMWQJUPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.ClH.H4N2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;;1-2/h1-9H;1H;1-2H2.
What are the key properties of hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride?
hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride has a molecular weight of 295.73 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;(4-nitrophenyl)-phenylmethanone;hydrochloride is sourced from PubChem (CID 172745216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).