About 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone
1-aminoethylurea;(4-nitrophenyl)-phenylmethanone (PubChem CID 174426591) has the molecular formula C16H18N4O4
and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone |
| PubChem CID | 174426591 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone |
| SMILES | CC(N)NC(N)=O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.C3H9N3O/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-2(4)6-3(5)7/h1-9H;2H,4H2,1H3,(H3,5,6,7) |
| InChIKey | NCYFAVSTXXGANX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone?
The IUPAC name of 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone (CID 174426591) is 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone.
What is the SMILES notation for 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone?
The canonical SMILES for 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone is CC(N)NC(N)=O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone?
The InChIKey is NCYFAVSTXXGANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C3H9N3O/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-2(4)6-3(5)7/h1-9H;2H,4H2,1H3,(H3,5,6,7).
What are the key properties of 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone?
1-aminoethylurea;(4-nitrophenyl)-phenylmethanone has a molecular weight of 330.34 g/mol, XLogP of 1.79, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethylurea;(4-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 174426591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).