About carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride
carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride (PubChem CID 175319577) has the molecular formula C14H12ClNO6
and a molecular weight of 325.70 g/mol. Its IUPAC name is carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride.
Molecular Properties
| Compound Name | carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride |
| PubChem CID | 175319577 |
| Molecular Formula | C14H12ClNO6 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride |
| SMILES | Cl.O=C(O)O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.CH2O3.ClH/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;2-1(3)4;/h1-9H;(H2,2,3,4);1H |
| InChIKey | JQLRXNFJBXPHQL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride?
The IUPAC name of carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride (CID 175319577) is carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride.
What is the SMILES notation for carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride?
The canonical SMILES for carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride is Cl.O=C(O)O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride?
The InChIKey is JQLRXNFJBXPHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.CH2O3.ClH/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;2-1(3)4;/h1-9H;(H2,2,3,4);1H.
What are the key properties of carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride?
carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride has a molecular weight of 325.70 g/mol, XLogP of 3.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;(4-nitrophenyl)-phenylmethanone;hydrochloride is sourced from PubChem (CID 175319577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).