About (4-nitrophenyl)-phenylmethanone;oxaldehydic acid
(4-nitrophenyl)-phenylmethanone;oxaldehydic acid (PubChem CID 175307297) has the molecular formula C15H11NO6
and a molecular weight of 301.25 g/mol. Its IUPAC name is (4-nitrophenyl)-phenylmethanone;oxaldehydic acid.
Molecular Properties
| Compound Name | (4-nitrophenyl)-phenylmethanone;oxaldehydic acid |
| PubChem CID | 175307297 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (4-nitrophenyl)-phenylmethanone;oxaldehydic acid |
| SMILES | O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.O=CC(=O)O |
| InChI | InChI=1S/C13H9NO3.C2H2O3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;3-1-2(4)5/h1-9H;1H,(H,4,5) |
| InChIKey | MYPVPZXNHWCIJX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-phenylmethanone;oxaldehydic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-phenylmethanone;oxaldehydic acid?
The IUPAC name of (4-nitrophenyl)-phenylmethanone;oxaldehydic acid (CID 175307297) is (4-nitrophenyl)-phenylmethanone;oxaldehydic acid.
What is the SMILES notation for (4-nitrophenyl)-phenylmethanone;oxaldehydic acid?
The canonical SMILES for (4-nitrophenyl)-phenylmethanone;oxaldehydic acid is O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.O=CC(=O)O.
What is the InChIKey of (4-nitrophenyl)-phenylmethanone;oxaldehydic acid?
The InChIKey is MYPVPZXNHWCIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C2H2O3/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;3-1-2(4)5/h1-9H;1H,(H,4,5).
What are the key properties of (4-nitrophenyl)-phenylmethanone;oxaldehydic acid?
(4-nitrophenyl)-phenylmethanone;oxaldehydic acid has a molecular weight of 301.25 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-phenylmethanone;oxaldehydic acid is sourced from PubChem (CID 175307297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).