About (4-nitrophenyl)-phenylmethanone;propan-2-ol
(4-nitrophenyl)-phenylmethanone;propan-2-ol (PubChem CID 174454674) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is (4-nitrophenyl)-phenylmethanone;propan-2-ol.
Molecular Properties
| Compound Name | (4-nitrophenyl)-phenylmethanone;propan-2-ol |
| PubChem CID | 174454674 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (4-nitrophenyl)-phenylmethanone;propan-2-ol |
| SMILES | CC(C)O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.C3H8O/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-3(2)4/h1-9H;3-4H,1-2H3 |
| InChIKey | LREURNHVSBRNQF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-phenylmethanone;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-phenylmethanone;propan-2-ol?
The IUPAC name of (4-nitrophenyl)-phenylmethanone;propan-2-ol (CID 174454674) is (4-nitrophenyl)-phenylmethanone;propan-2-ol.
What is the SMILES notation for (4-nitrophenyl)-phenylmethanone;propan-2-ol?
The canonical SMILES for (4-nitrophenyl)-phenylmethanone;propan-2-ol is CC(C)O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)-phenylmethanone;propan-2-ol?
The InChIKey is LREURNHVSBRNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C3H8O/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-3(2)4/h1-9H;3-4H,1-2H3.
What are the key properties of (4-nitrophenyl)-phenylmethanone;propan-2-ol?
(4-nitrophenyl)-phenylmethanone;propan-2-ol has a molecular weight of 287.32 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-phenylmethanone;propan-2-ol is sourced from PubChem (CID 174454674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).