About methanediimine;bis((4-nitrophenyl)-phenylmethanone)
methanediimine;bis((4-nitrophenyl)-phenylmethanone) (PubChem CID 174915149) has the molecular formula C27H20N4O6
and a molecular weight of 496.48 g/mol. Its IUPAC name is methanediimine;bis((4-nitrophenyl)-phenylmethanone).
Molecular Properties
| Compound Name | methanediimine;bis((4-nitrophenyl)-phenylmethanone) |
| PubChem CID | 174915149 |
| Molecular Formula | C27H20N4O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | methanediimine;bis((4-nitrophenyl)-phenylmethanone) |
| SMILES | N=C=N.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C13H9NO3.CH2N2/c2*15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;2-1-3/h2*1-9H;2-3H |
| InChIKey | IPSMVBIMICXZHQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 168.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanediimine;bis((4-nitrophenyl)-phenylmethanone) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanediimine;bis((4-nitrophenyl)-phenylmethanone)?
The IUPAC name of methanediimine;bis((4-nitrophenyl)-phenylmethanone) (CID 174915149) is methanediimine;bis((4-nitrophenyl)-phenylmethanone).
What is the SMILES notation for methanediimine;bis((4-nitrophenyl)-phenylmethanone)?
The canonical SMILES for methanediimine;bis((4-nitrophenyl)-phenylmethanone) is N=C=N.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methanediimine;bis((4-nitrophenyl)-phenylmethanone)?
The InChIKey is IPSMVBIMICXZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H9NO3.CH2N2/c2*15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;2-1-3/h2*1-9H;2-3H.
What are the key properties of methanediimine;bis((4-nitrophenyl)-phenylmethanone)?
methanediimine;bis((4-nitrophenyl)-phenylmethanone) has a molecular weight of 496.48 g/mol, XLogP of 5.97, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methanediimine;bis((4-nitrophenyl)-phenylmethanone) is sourced from PubChem (CID 174915149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).