About (4-benzoylphenyl) 4-nitrobenzoate
(4-benzoylphenyl) 4-nitrobenzoate (PubChem CID 2678928) has the molecular formula C20H13NO5
and a molecular weight of 347.33 g/mol. Its IUPAC name is (4-benzoylphenyl) 4-nitrobenzoate.
Molecular Properties
| Compound Name | (4-benzoylphenyl) 4-nitrobenzoate |
| PubChem CID | 2678928 |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (4-benzoylphenyl) 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc(C(=O)c2ccccc2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H13NO5/c22-19(14-4-2-1-3-5-14)15-8-12-18(13-9-15)26-20(23)16-6-10-17(11-7-16)21(24)25/h1-13H |
| InChIKey | GCAYCQHJEJGCNQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-benzoylphenyl) 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoylphenyl) 4-nitrobenzoate?
The IUPAC name of (4-benzoylphenyl) 4-nitrobenzoate (CID 2678928) is (4-benzoylphenyl) 4-nitrobenzoate.
What is the SMILES notation for (4-benzoylphenyl) 4-nitrobenzoate?
The canonical SMILES for (4-benzoylphenyl) 4-nitrobenzoate is O=C(Oc1ccc(C(=O)c2ccccc2)cc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-benzoylphenyl) 4-nitrobenzoate?
The InChIKey is GCAYCQHJEJGCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13NO5/c22-19(14-4-2-1-3-5-14)15-8-12-18(13-9-15)26-20(23)16-6-10-17(11-7-16)21(24)25/h1-13H.
What are the key properties of (4-benzoylphenyl) 4-nitrobenzoate?
(4-benzoylphenyl) 4-nitrobenzoate has a molecular weight of 347.33 g/mol, XLogP of 4.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoylphenyl) 4-nitrobenzoate is sourced from PubChem (CID 2678928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).