About ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate
ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate (PubChem CID 143832405) has the molecular formula C21H20N2O5S
and a molecular weight of 412.47 g/mol. Its IUPAC name is ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate.
Molecular Properties
| Compound Name | ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate |
| PubChem CID | 143832405 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate |
| SMILES | CC.O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccc(S(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H14N2O5S.C2H6/c22-19(26-17-10-8-16(9-11-17)21(23)24)14-6-12-18(13-7-14)27(25)20-15-4-2-1-3-5-15;1-2/h1-13,20H;1-2H3 |
| InChIKey | FZTCQIHLSZCEOC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate?
The IUPAC name of ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate (CID 143832405) is ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate.
What is the SMILES notation for ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate?
The canonical SMILES for ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate is CC.O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccc(S(=O)Nc2ccccc2)cc1.
What is the InChIKey of ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate?
The InChIKey is FZTCQIHLSZCEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O5S.C2H6/c22-19(26-17-10-8-16(9-11-17)21(23)24)14-6-12-18(13-7-14)27(25)20-15-4-2-1-3-5-15;1-2/h1-13,20H;1-2H3.
What are the key properties of ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate?
ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate has a molecular weight of 412.47 g/mol, XLogP of 4.97, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-nitrophenyl) 4-phenylsulfinamoylbenzoate is sourced from PubChem (CID 143832405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).