About 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate
1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate (PubChem CID 174914751) has the molecular formula C14H10NO6P
and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate |
| PubChem CID | 174914751 |
| Molecular Formula | C14H10NO6P |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate |
| SMILES | O=C(OP)c1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10NO6P/c16-13(11-3-1-2-4-12(11)14(17)21-22)20-10-7-5-9(6-8-10)15(18)19/h1-8H,22H2 |
| InChIKey | MTSDLCXDLJMHSP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate?
The IUPAC name of 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate (CID 174914751) is 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate.
What is the SMILES notation for 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate?
The canonical SMILES for 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate is O=C(OP)c1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate?
The InChIKey is MTSDLCXDLJMHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10NO6P/c16-13(11-3-1-2-4-12(11)14(17)21-22)20-10-7-5-9(6-8-10)15(18)19/h1-8H,22H2.
What are the key properties of 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate?
1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate has a molecular weight of 319.21 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(4-nitrophenyl) 2-O-phosphanyl benzene-1,2-dicarboxylate is sourced from PubChem (CID 174914751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).