C17H10N4O4 — CID 168541495
(4-nitrophenyl) 2-(2,2-dicyanoethenylamino)benzoate (PubChem CID 168541495) has the molecular formula C17H10N4O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is (4-nitrophenyl) 2-(2,2-dicyanoethenylamino)benzoate.
| Compound Name | (4-nitrophenyl) 2-(2,2-dicyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168541495 |
| Molecular Formula | C17H10N4O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (4-nitrophenyl) 2-(2,2-dicyanoethenylamino)benzoate |
| SMILES | N#CC(C#N)=CNc1ccccc1C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H10N4O4/c18-9-12(10-19)11-20-16-4-2-1-3-15(16)17(22)25-14-7-5-13(6-8-14)21(23)24/h1-8,11,20H |
| InChIKey | FEXAVFNCPMYDQM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|