C21H14N6O2 — CID 169343846
naphthalen-2-yl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate (PubChem CID 169343846) has the molecular formula C21H14N6O2 and a molecular weight of 382.38 g/mol. Its IUPAC name is naphthalen-2-yl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate.
| Compound Name | naphthalen-2-yl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 169343846 |
| Molecular Formula | C21H14N6O2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | naphthalen-2-yl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate |
| SMILES | N#CC(=CNc1ccccc1C(=O)Oc1ccc2ccccc2c1)c1nn[nH]n1 |
| InChI | InChI=1S/C21H14N6O2/c22-12-16(20-24-26-27-25-20)13-23-19-8-4-3-7-18(19)21(28)29-17-10-9-14-5-1-2-6-15(14)11-17/h1-11,13,23H,(H,24,25,26,27) |
| InChIKey | FEIOIWGYERQZLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|