C19H23N7O — CID 169343082
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-cyclooctylbenzamide (PubChem CID 169343082) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-cyclooctylbenzamide.
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-cyclooctylbenzamide |
|---|---|
| PubChem CID | 169343082 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-cyclooctylbenzamide |
| SMILES | N#CC(=CNc1ccccc1C(=O)NC1CCCCCCC1)c1nn[nH]n1 |
| InChI | InChI=1S/C19H23N7O/c20-12-14(18-23-25-26-24-18)13-21-17-11-7-6-10-16(17)19(27)22-15-8-4-2-1-3-5-9-15/h6-7,10-11,13,15,21H,1-5,8-9H2,(H,22,27)(H,23,24,25,26) |
| InChIKey | WXGWILABGFRLKS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|