C10H6BrFN6 — CID 169342446
3-(3-bromo-2-fluoroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342446) has the molecular formula C10H6BrFN6 and a molecular weight of 309.10 g/mol. Its IUPAC name is 3-(3-bromo-2-fluoroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(3-bromo-2-fluoroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342446 |
| Molecular Formula | C10H6BrFN6 |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 3-(3-bromo-2-fluoroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc(Br)c1F)c1nn[nH]n1 |
| InChI | InChI=1S/C10H6BrFN6/c11-7-2-1-3-8(9(7)12)14-5-6(4-13)10-15-17-18-16-10/h1-3,5,14H,(H,15,16,17,18) |
| InChIKey | VSJCOVWBBGQIGN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|