C11H7Br2FN6 — CID 169346600
3-(4,6-dibromo-2-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346600) has the molecular formula C11H7Br2FN6 and a molecular weight of 402.03 g/mol. Its IUPAC name is 3-(4,6-dibromo-2-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(4,6-dibromo-2-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346600 |
| Molecular Formula | C11H7Br2FN6 |
| Molecular Weight | 402.03 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | 3-(4,6-dibromo-2-fluoro-3-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1c(Br)cc(Br)c(NC=C(C#N)c2nn[nH]n2)c1F |
| InChI | InChI=1S/C11H7Br2FN6/c1-5-7(12)2-8(13)10(9(5)14)16-4-6(3-15)11-17-19-20-18-11/h2,4,16H,1H3,(H,17,18,19,20) |
| InChIKey | FNABSANVXGMMQH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.03 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|