C12H11BrN6 — CID 169346655
3-(4-bromo-2,6-dimethylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346655) has the molecular formula C12H11BrN6 and a molecular weight of 319.17 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(4-bromo-2,6-dimethylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346655 |
| Molecular Formula | C12H11BrN6 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(Br)cc(C)c1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C12H11BrN6/c1-7-3-10(13)4-8(2)11(7)15-6-9(5-14)12-16-18-19-17-12/h3-4,6,15H,1-2H3,(H,16,17,18,19) |
| InChIKey | UHPCKURPYNYRPJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|