C19H11BrN6O2 — CID 169343708
3-[(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343708) has the molecular formula C19H11BrN6O2 and a molecular weight of 435.24 g/mol. Its IUPAC name is 3-[(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343708 |
| Molecular Formula | C19H11BrN6O2 |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 3-[(4-bromo-2-methyl-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(Br)c2c(c1NC=C(C#N)c1nn[nH]n1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H11BrN6O2/c1-9-6-13(20)14-15(18(28)12-5-3-2-4-11(12)17(14)27)16(9)22-8-10(7-21)19-23-25-26-24-19/h2-6,8,22H,1H3,(H,23,24,25,26) |
| InChIKey | ALQKGDZSBSJVKW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|