C18H9BrN6O3 — CID 169346612
3-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346612) has the molecular formula C18H9BrN6O3 and a molecular weight of 437.21 g/mol. Its IUPAC name is 3-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346612 |
| Molecular Formula | C18H9BrN6O3 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 3-[(2-bromo-4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c(Br)cc(O)c2c1C(=O)c1ccccc1C2=O)c1nn[nH]n1 |
| InChI | InChI=1S/C18H9BrN6O3/c19-11-5-12(26)13-14(17(28)10-4-2-1-3-9(10)16(13)27)15(11)21-7-8(6-20)18-22-24-25-23-18/h1-5,7,21,26H,(H,22,23,24,25) |
| InChIKey | DRRAJTZPMXWLOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|