C10H6BrFN6O — CID 169346711
3-(3-bromo-2-fluoro-6-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346711) has the molecular formula C10H6BrFN6O and a molecular weight of 325.10 g/mol. Its IUPAC name is 3-(3-bromo-2-fluoro-6-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(3-bromo-2-fluoro-6-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346711 |
| Molecular Formula | C10H6BrFN6O |
| Molecular Weight | 325.10 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-(3-bromo-2-fluoro-6-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c(O)ccc(Br)c1F)c1nn[nH]n1 |
| InChI | InChI=1S/C10H6BrFN6O/c11-6-1-2-7(19)9(8(6)12)14-4-5(3-13)10-15-17-18-16-10/h1-2,4,14,19H,(H,15,16,17,18) |
| InChIKey | WBYAFHSTKKLZQX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|