C10H7FN6O — CID 169342431
3-(2-fluoro-5-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342431) has the molecular formula C10H7FN6O and a molecular weight of 246.21 g/mol. Its IUPAC name is 3-(2-fluoro-5-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-fluoro-5-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342431 |
| Molecular Formula | C10H7FN6O |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-(2-fluoro-5-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(O)ccc1F)c1nn[nH]n1 |
| InChI | InChI=1S/C10H7FN6O/c11-8-2-1-7(18)3-9(8)13-5-6(4-12)10-14-16-17-15-10/h1-3,5,13,18H,(H,14,15,16,17) |
| InChIKey | AUVYGTSRNAMAEA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|