C11H8F2N6O — CID 169343895
3-(3,4-difluoro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343895) has the molecular formula C11H8F2N6O and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-(3,4-difluoro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(3,4-difluoro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343895 |
| Molecular Formula | C11H8F2N6O |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(3,4-difluoro-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | COc1c(NC=C(C#N)c2nn[nH]n2)ccc(F)c1F |
| InChI | InChI=1S/C11H8F2N6O/c1-20-10-8(3-2-7(12)9(10)13)15-5-6(4-14)11-16-18-19-17-11/h2-3,5,15H,1H3,(H,16,17,18,19) |
| InChIKey | PGTNILURYYGHAN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|