C12H9F3N6O — CID 169343903
3-[3-methoxy-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343903) has the molecular formula C12H9F3N6O and a molecular weight of 310.24 g/mol. Its IUPAC name is 3-[3-methoxy-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-methoxy-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343903 |
| Molecular Formula | C12H9F3N6O |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[3-methoxy-2-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | COc1cccc(NC=C(C#N)c2nn[nH]n2)c1C(F)(F)F |
| InChI | InChI=1S/C12H9F3N6O/c1-22-9-4-2-3-8(10(9)12(13,14)15)17-6-7(5-16)11-18-20-21-19-11/h2-4,6,17H,1H3,(H,18,19,20,21) |
| InChIKey | RTTAAGKRSHFAQR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|