C13H11F3N6O — CID 169343030
3-[2-ethoxy-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343030) has the molecular formula C13H11F3N6O and a molecular weight of 324.27 g/mol. Its IUPAC name is 3-[2-ethoxy-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-ethoxy-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343030 |
| Molecular Formula | C13H11F3N6O |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-[2-ethoxy-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CCOc1ccc(C(F)(F)F)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C13H11F3N6O/c1-2-23-11-4-3-9(13(14,15)16)5-10(11)18-7-8(6-17)12-19-21-22-20-12/h3-5,7,18H,2H2,1H3,(H,19,20,21,22) |
| InChIKey | VRJIVPNSBMANMS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|