C15H11F3N8 — CID 169344960
3-[2-(2-methylimidazol-1-yl)-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344960) has the molecular formula C15H11F3N8 and a molecular weight of 360.30 g/mol. Its IUPAC name is 3-[2-(2-methylimidazol-1-yl)-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(2-methylimidazol-1-yl)-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344960 |
| Molecular Formula | C15H11F3N8 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-[2-(2-methylimidazol-1-yl)-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1nccn1-c1ccc(C(F)(F)F)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C15H11F3N8/c1-9-20-4-5-26(9)13-3-2-11(15(16,17)18)6-12(13)21-8-10(7-19)14-22-24-25-23-14/h2-6,8,21H,1H3,(H,22,23,24,25) |
| InChIKey | DZBWJENVZIUZIJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|