C15H10F3N7 — CID 169345431
3-[2-pyrrol-1-yl-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345431) has the molecular formula C15H10F3N7 and a molecular weight of 345.29 g/mol. Its IUPAC name is 3-[2-pyrrol-1-yl-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-pyrrol-1-yl-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345431 |
| Molecular Formula | C15H10F3N7 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[2-pyrrol-1-yl-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(C(F)(F)F)ccc1-n1cccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H10F3N7/c16-15(17,18)11-3-4-13(25-5-1-2-6-25)12(7-11)20-9-10(8-19)14-21-23-24-22-14/h1-7,9,20H,(H,21,22,23,24) |
| InChIKey | VESDTMWJIFIEIU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|