C11H5F4IN6 — CID 169344997
3-[3-fluoro-2-iodo-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344997) has the molecular formula C11H5F4IN6 and a molecular weight of 424.10 g/mol. Its IUPAC name is 3-[3-fluoro-2-iodo-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-fluoro-2-iodo-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344997 |
| Molecular Formula | C11H5F4IN6 |
| Molecular Weight | 424.10 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 3-[3-fluoro-2-iodo-5-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(C(F)(F)F)cc(F)c1I)c1nn[nH]n1 |
| InChI | InChI=1S/C11H5F4IN6/c12-7-1-6(11(13,14)15)2-8(9(7)16)18-4-5(3-17)10-19-21-22-20-10/h1-2,4,18H,(H,19,20,21,22) |
| InChIKey | TYHSDHPOZHVDKV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|