C12H7BrF4N6O — CID 169345835
3-[4-bromo-5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345835) has the molecular formula C12H7BrF4N6O and a molecular weight of 407.13 g/mol. Its IUPAC name is 3-[4-bromo-5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-bromo-5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345835 |
| Molecular Formula | C12H7BrF4N6O |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 3-[4-bromo-5-fluoro-2-(2,2,2-trifluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c(Br)cc1OCC(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C12H7BrF4N6O/c13-7-1-10(24-5-12(15,16)17)9(2-8(7)14)19-4-6(3-18)11-20-22-23-21-11/h1-2,4,19H,5H2,(H,20,21,22,23) |
| InChIKey | RXTLJSJGZJIRIV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|