C12H10F2N6O — CID 169343455
3-[2-(2,2-difluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343455) has the molecular formula C12H10F2N6O and a molecular weight of 292.25 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(2,2-difluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343455 |
| Molecular Formula | C12H10F2N6O |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccccc1OCC(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C12H10F2N6O/c13-11(14)7-21-10-4-2-1-3-9(10)16-6-8(5-15)12-17-19-20-18-12/h1-4,6,11,16H,7H2,(H,17,18,19,20) |
| InChIKey | NSRUVGSYINHFTN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|