C17H13FN6S — CID 169343307
3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343307) has the molecular formula C17H13FN6S and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343307 |
| Molecular Formula | C17H13FN6S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccccc1SCc1ccccc1F)c1nn[nH]n1 |
| InChI | InChI=1S/C17H13FN6S/c18-14-6-2-1-5-12(14)11-25-16-8-4-3-7-15(16)20-10-13(9-19)17-21-23-24-22-17/h1-8,10,20H,11H2,(H,21,22,23,24) |
| InChIKey | BMCJYJVZMOAJDZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|