C15H17N7 — CID 169342822
3-[2-(pyrrolidin-1-ylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342822) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is 3-[2-(pyrrolidin-1-ylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(pyrrolidin-1-ylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342822 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-[2-(pyrrolidin-1-ylmethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccccc1CN1CCCC1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H17N7/c16-9-13(15-18-20-21-19-15)10-17-14-6-2-1-5-12(14)11-22-7-3-4-8-22/h1-2,5-6,10,17H,3-4,7-8,11H2,(H,18,19,20,21) |
| InChIKey | OFQMXEAMQCJNSS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|