C13H12N8O — CID 169345713
3-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345713) has the molecular formula C13H12N8O and a molecular weight of 296.29 g/mol. Its IUPAC name is 3-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345713 |
| Molecular Formula | C13H12N8O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc2c1NCCNC2=O)c1nn[nH]n1 |
| InChI | InChI=1S/C13H12N8O/c14-6-8(12-18-20-21-19-12)7-17-10-3-1-2-9-11(10)15-4-5-16-13(9)22/h1-3,7,15,17H,4-5H2,(H,16,22)(H,18,19,20,21) |
| InChIKey | FQDADPQCDIGYMD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|